CAS 1432677-92-3 is the registry number for 1-(1,3-Dihydro-2-benzofuran-5-ylmethyl)piperazine dihydrochloride, 95%. Offered by: AmBeed. Available pack sizes: 1g.
1-(1,3-dihydro-2-benzofuran-5-ylmethyl)piperazine;dihydrochloride (CAS 1432677-92-3) is a chemical compound with the molecular formula C13H20Cl2N2O and a molecular weight of 291.21 g/mol. IUPAC name: 1-(1,3-dihydro-2-benzofuran-5-ylmethyl)piperazine;dihydrochloride. InChIKey: YJDANRMJLBKQRS-UHFFFAOYSA-N.
| Molecular formula | C13H20Cl2N2O |
|---|---|
| Molecular weight | 291.21 g/mol |
| IUPAC name | 1-(1,3-dihydro-2-benzofuran-5-ylmethyl)piperazine;dihydrochloride |
| InChIKey | YJDANRMJLBKQRS-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)CC2=CC3=C(COC3)C=C2.Cl.Cl |
Computed by PubChem (NCBI)