CAS 88151-07-9 is the registry number for Clenbuterol Impurity 17. Offered by: Chemat Brand. Available pack sizes: on request.
4-[2-(tert-butylamino)-1-methoxyethyl]-2,6-dichloroaniline (CAS 88151-07-9) is a chemical compound with the molecular formula C13H20Cl2N2O and a molecular weight of 291.21 g/mol. IUPAC name: 4-[2-(tert-butylamino)-1-methoxyethyl]-2,6-dichloroaniline. InChIKey: VJRSBWGAZXPNDD-UHFFFAOYSA-N.
| Molecular formula | C13H20Cl2N2O |
|---|---|
| Molecular weight | 291.21 g/mol |
| IUPAC name | 4-[2-(tert-butylamino)-1-methoxyethyl]-2,6-dichloroaniline |
| InChIKey | VJRSBWGAZXPNDD-UHFFFAOYSA-N |
| SMILES | CC(C)(C)NCC(C1=CC(=C(C(=C1)Cl)N)Cl)OC |
Computed by PubChem (NCBI)