CAS 157664-68-1 is the registry number for Clenisopenterol. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 250mg.
1-(4-amino-3,5-dichlorophenyl)-2-(3-methylbutylamino)ethanol (CAS 157664-68-1) is a chemical compound with the molecular formula C13H20Cl2N2O and a molecular weight of 291.21 g/mol. IUPAC name: 1-(4-amino-3,5-dichlorophenyl)-2-(3-methylbutylamino)ethanol. InChIKey: KWAPEXIWYNEGAV-UHFFFAOYSA-N.
| Molecular formula | C13H20Cl2N2O |
|---|---|
| Molecular weight | 291.21 g/mol |
| IUPAC name | 1-(4-amino-3,5-dichlorophenyl)-2-(3-methylbutylamino)ethanol |
| InChIKey | KWAPEXIWYNEGAV-UHFFFAOYSA-N |
| SMILES | CC(C)CCNCC(C1=CC(=C(C(=C1)Cl)N)Cl)O |
Computed by PubChem (NCBI)