CAS 1432678-03-9 appears in our catalog under these names: 9-Chloro-2,3,4,5-tetrahydro-1-benzoxepin-5-amine hydrochloride, 98%, 9-Chloro-2,3,4,5-tetrahydro-1-benzoxepin-5-amine hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 10g, 1g, 5g, 0,5g, 50mg.
9-chloro-2,3,4,5-tetrahydro-1-benzoxepin-5-amine;hydrochloride (CAS 1432678-03-9) is a chemical compound with the molecular formula C10H13Cl2NO and a molecular weight of 234.12 g/mol. IUPAC name: 9-chloro-2,3,4,5-tetrahydro-1-benzoxepin-5-amine;hydrochloride. InChIKey: NOVYMKIZWZFVQQ-UHFFFAOYSA-N.
| Molecular formula | C10H13Cl2NO |
|---|---|
| Molecular weight | 234.12 g/mol |
| IUPAC name | 9-chloro-2,3,4,5-tetrahydro-1-benzoxepin-5-amine;hydrochloride |
| InChIKey | NOVYMKIZWZFVQQ-UHFFFAOYSA-N |
| SMILES | C1CC(C2=C(C(=CC=C2)Cl)OC1)N.Cl |
Computed by PubChem (NCBI)