CAS 1432679-00-9 appears in our catalog under these names: 8-Fluoro-2,3,4,5-tetrahydro-1-benzoxepin-5-amine hydrochloride, 95%, 8-Fluoro-2,3,4,5-tetrahydro-1-benzoxepin-5-amine hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
8-fluoro-2,3,4,5-tetrahydro-1-benzoxepin-5-amine;hydrochloride (CAS 1432679-00-9) is a chemical compound with the molecular formula C10H13ClFNO and a molecular weight of 217.67 g/mol. IUPAC name: 8-fluoro-2,3,4,5-tetrahydro-1-benzoxepin-5-amine;hydrochloride. InChIKey: UJIFILSJQAMBEZ-UHFFFAOYSA-N.
| Molecular formula | C10H13ClFNO |
|---|---|
| Molecular weight | 217.67 g/mol |
| IUPAC name | 8-fluoro-2,3,4,5-tetrahydro-1-benzoxepin-5-amine;hydrochloride |
| InChIKey | UJIFILSJQAMBEZ-UHFFFAOYSA-N |
| SMILES | C1CC(C2=C(C=C(C=C2)F)OC1)N.Cl |
Computed by PubChem (NCBI)