CAS 1432681-27-0 appears in our catalog under these names: (1S)-1-(5-Chlorothiophen-2-yl)ethan-1-amine hydrochloride, (1s)-1-(5-Chlorothiophen-2-yl)ethan-1-amine hydrochloride, 95%, 95%, (1s)-1-(5-Chlorothiophen-2-yl)ethan-1-amine hydrochloride, 97%. Offered by: Biosynth, Chemat, Fluorochem. Available pack sizes: 2,5g, 250mg, 100mg, 1g.
(1S)-1-(5-chlorothiophen-2-yl)ethanamine;hydrochloride (CAS 1432681-27-0) is a chemical compound with the molecular formula C6H9Cl2NS and a molecular weight of 198.11 g/mol. IUPAC name: (1S)-1-(5-chlorothiophen-2-yl)ethanamine;hydrochloride. InChIKey: QBNZSVFQOHBMAA-WCCKRBBISA-N.
| Molecular formula | C6H9Cl2NS |
|---|---|
| Molecular weight | 198.11 g/mol |
| IUPAC name | (1S)-1-(5-chlorothiophen-2-yl)ethanamine;hydrochloride |
| InChIKey | QBNZSVFQOHBMAA-WCCKRBBISA-N |
| SMILES | C[C@@H](C1=CC=C(S1)Cl)N.Cl |
Computed by PubChem (NCBI)