Products 1609401-09-3

CAS 1609401-09-3 is the registry number for 4-(2-Chloroethyl)-2-methyl-1,3-thiazole hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.

Structural formula: {0} (CAS {1})

4-(2-chloroethyl)-2-methyl-1,3-thiazole;hydrochloride (CAS 1609401-09-3) is a chemical compound with the molecular formula C6H9Cl2NS and a molecular weight of 198.11 g/mol. IUPAC name: 4-(2-chloroethyl)-2-methyl-1,3-thiazole;hydrochloride. InChIKey: HHWKGEBESBSMAB-UHFFFAOYSA-N.

Identity
Molecular formulaC6H9Cl2NS
Molecular weight198.11 g/mol
IUPAC name4-(2-chloroethyl)-2-methyl-1,3-thiazole;hydrochloride
InChIKeyHHWKGEBESBSMAB-UHFFFAOYSA-N
SMILESCC1=NC(=CS1)CCCl.Cl

Computed by PubChem (NCBI)