Products 91615-75-7

CAS 91615-75-7 is the registry number for 5-(Chloromethyl)-2,4-dimethyl-1,3-thiazole hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.

Structural formula: {0} (CAS {1})

5-(chloromethyl)-2,4-dimethyl-1,3-thiazole;hydrochloride (CAS 91615-75-7) is a chemical compound with the molecular formula C6H9Cl2NS and a molecular weight of 198.11 g/mol. IUPAC name: 5-(chloromethyl)-2,4-dimethyl-1,3-thiazole;hydrochloride. InChIKey: KVDIALDTERGAHM-UHFFFAOYSA-N.

Identity
Molecular formulaC6H9Cl2NS
Molecular weight198.11 g/mol
IUPAC name5-(chloromethyl)-2,4-dimethyl-1,3-thiazole;hydrochloride
InChIKeyKVDIALDTERGAHM-UHFFFAOYSA-N
SMILESCC1=C(SC(=N1)C)CCl.Cl

Computed by PubChem (NCBI)