CAS 1432742-62-5 is the registry number for 2,4-Difluoro-2'-methyl-1,1'-biphenyl, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 1g.
2,4-difluoro-1-(2-methylphenyl)benzene (CAS 1432742-62-5) is a chemical compound with the molecular formula C13H10F2 and a molecular weight of 204.21 g/mol. IUPAC name: 2,4-difluoro-1-(2-methylphenyl)benzene. InChIKey: PQNGZXSTMLTGAY-UHFFFAOYSA-N.
| Molecular formula | C13H10F2 |
|---|---|
| Molecular weight | 204.21 g/mol |
| IUPAC name | 2,4-difluoro-1-(2-methylphenyl)benzene |
| InChIKey | PQNGZXSTMLTGAY-UHFFFAOYSA-N |
| SMILES | CC1=CC=CC=C1C2=C(C=C(C=C2)F)F |
Computed by PubChem (NCBI)