CAS 182169-64-8 is the registry number for 3,4-Difluoro-4'-methyl-1,1'-biphenyl, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 1g.
1,2-difluoro-4-(4-methylphenyl)benzene (CAS 182169-64-8) is a chemical compound with the molecular formula C13H10F2 and a molecular weight of 204.21 g/mol. IUPAC name: 1,2-difluoro-4-(4-methylphenyl)benzene. InChIKey: LZFVBOHSKRRDEL-UHFFFAOYSA-N.
| Molecular formula | C13H10F2 |
|---|---|
| Molecular weight | 204.21 g/mol |
| IUPAC name | 1,2-difluoro-4-(4-methylphenyl)benzene |
| InChIKey | LZFVBOHSKRRDEL-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=CC(=C(C=C2)F)F |
Computed by PubChem (NCBI)