CAS 97067-20-4 appears in our catalog under these names: 3,5-Difluoro-4'-methyl-1,1'-biphenyl, 95%, 3,5-Difluoro-4'-methyl-1,1'-biphenyl, ≥95%, 3,5-Difluoro-4'-methyl-1,1'-biphenyl, ≥95%, ≥95%. Offered by: Combi-blocks, Fluorochem, Chemat. Available pack sizes: 10g, 5g, 25g, 1g, 250mg.
1,3-difluoro-5-(4-methylphenyl)benzene (CAS 97067-20-4) is a chemical compound with the molecular formula C13H10F2 and a molecular weight of 204.21 g/mol. IUPAC name: 1,3-difluoro-5-(4-methylphenyl)benzene. InChIKey: GQEKCTAHFDPTQJ-UHFFFAOYSA-N.
| Molecular formula | C13H10F2 |
|---|---|
| Molecular weight | 204.21 g/mol |
| IUPAC name | 1,3-difluoro-5-(4-methylphenyl)benzene |
| InChIKey | GQEKCTAHFDPTQJ-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=CC(=CC(=C2)F)F |
Computed by PubChem (NCBI)