Products 143339-12-2
CAS 143339-12-2 appears in our catalog under these names: RS 056812-198 Hydrochloride, RS 56812 hydrochloride/ 97.69% (existing batch purity), RS 56812 hydrochloride, RS 56812 hydrochloride, (R)-RS 56812 (hydrochloride). Offered by: TRC, TargetMol, GLPBio, Biosynth, Chemat. Available pack sizes: 250mg, 1mg, 2mg, 5mg, 10mg, 25mg, 50mg, 100mg.
N-[(3R)-1-azabicyclo[2.2.2]octan-3-yl]-2-(1-methylindol-3-yl)-2-oxoacetamide;hydrochloride (CAS 143339-12-2) is a chemical compound with the molecular formula C18H22ClN3O2 and a molecular weight of 347.8 g/mol. IUPAC name: N-[(3R)-1-azabicyclo[2.2.2]octan-3-yl]-2-(1-methylindol-3-yl)-2-oxoacetamide;hydrochloride. InChIKey: NHWCYXITJPBOHX-RSAXXLAASA-N.
| Molecular formula | C18H22ClN3O2 |
|---|---|
| Molecular weight | 347.8 g/mol |
| IUPAC name | N-[(3R)-1-azabicyclo[2.2.2]octan-3-yl]-2-(1-methylindol-3-yl)-2-oxoacetamide;hydrochloride |
| InChIKey | NHWCYXITJPBOHX-RSAXXLAASA-N |
| SMILES | CN1C=C(C2=CC=CC=C21)C(=O)C(=O)N[C@H]3CN4CCC3CC4.Cl |
Computed by PubChem (NCBI)