CAS 143382-03-0 appears in our catalog under these names: 5-(Methoxymethyl)pyridine-2,3-dicarboxylic acid, 95%, 95%, 5-Methoxymethyl-2,3-pyridine dicarboxylic acid. Offered by: Chemat, HPC Standards. Available pack sizes: 50mg, 250mg, 1x10mg.
5-(methoxymethyl)pyridine-2,3-dicarboxylic acid (CAS 143382-03-0) is a chemical compound with the molecular formula C9H9NO5 and a molecular weight of 211.17 g/mol. IUPAC name: 5-(methoxymethyl)pyridine-2,3-dicarboxylic acid. InChIKey: CJSGMWRJOBFTCK-UHFFFAOYSA-N.
| Molecular formula | C9H9NO5 |
|---|---|
| Molecular weight | 211.17 g/mol |
| IUPAC name | 5-(methoxymethyl)pyridine-2,3-dicarboxylic acid |
| InChIKey | CJSGMWRJOBFTCK-UHFFFAOYSA-N |
| SMILES | COCC1=CC(=C(N=C1)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)