Products 14341-88-9
CAS 14341-88-9 appears in our catalog under these names: D-Glutamic-2,3,3,4,4-d5 Acid, D-Glutamic Acid-d5, >95% (HPLC), D-Glutamic-2,3,3,4,4-d5 Acid, 98 atom % D, min 98% Chemical Purity, D–Glutamic Acid–d5, D-Glutamic acid-d5, 99.91%. Offered by: Chemat Brand, TRC, CDN, GLPBio, MedChemExpress. Available pack sizes: on request, 100mg, 10mg, 0,05g, 0,01g, 5mg, 5 mg, 10 mg.
(2R)-2-amino-2,3,3,4,4-pentadeuteriopentanedioic acid (CAS 14341-88-9) is a chemical compound with the molecular formula C5H9NO4 and a molecular weight of 152.16 g/mol. IUPAC name: (2R)-2-amino-2,3,3,4,4-pentadeuteriopentanedioic acid. InChIKey: WHUUTDBJXJRKMK-XSDLJHQPSA-N.
| Molecular formula | C5H9NO4 |
|---|---|
| Molecular weight | 152.16 g/mol |
| IUPAC name | (2R)-2-amino-2,3,3,4,4-pentadeuteriopentanedioic acid |
| InChIKey | WHUUTDBJXJRKMK-XSDLJHQPSA-N |
| SMILES | [2H][C@](C(=O)O)(C([2H])([2H])C([2H])([2H])C(=O)O)N |
Computed by PubChem (NCBI)