Products 202468-31-3
CAS 202468-31-3 appears in our catalog under these names: L-Glutamic Acid-13C5,15N, >95% (HPLC), L–Glutamic acid–13C5,15N, L-Glutamic acid-¹³C₅,¹⁵N, L-Glutamic acid-13C5,15N, 99.9%. Offered by: TRC, GLPBio, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 250mg, 5 mg, 1 mg, 10 mg.
(2S)-2-(15N)azanyl(1,2,3,4,5-13C5)pentanedioic acid (CAS 202468-31-3) is a chemical compound with the molecular formula C5H9NO4 and a molecular weight of 153.09 g/mol. IUPAC name: (2S)-2-(15N)azanyl(1,2,3,4,5-13C5)pentanedioic acid. InChIKey: WHUUTDBJXJRKMK-UFLWJPECSA-N.
| Molecular formula | C5H9NO4 |
|---|---|
| Molecular weight | 153.09 g/mol |
| IUPAC name | (2S)-2-(15N)azanyl(1,2,3,4,5-13C5)pentanedioic acid |
| InChIKey | WHUUTDBJXJRKMK-UFLWJPECSA-N |
| SMILES | [13CH2]([13CH2][13C](=O)O)[13C@@H]([13C](=O)O)[15NH2] |
Computed by PubChem (NCBI)