CAS 81201-99-2 appears in our catalog under these names: L-Glutamic acid-1-13C, 99%, 99%, L-Glutamic Acid (1-13C), L–Glutamic acid–1–13C, L-Glutamic acid-1-13C, 99.85%. Offered by: Chemat, Chemat Brand, GLPBio, MedChemExpress. Available pack sizes: 5mg, 10mg, 25mg, 50mg, on request, 5 mg, 100 mg, 50 mg.
(2S)-2-amino(113C)pentanedioic acid (CAS 81201-99-2) is a chemical compound with the molecular formula C5H9NO4 and a molecular weight of 148.12 g/mol. IUPAC name: (2S)-2-amino(113C)pentanedioic acid. InChIKey: WHUUTDBJXJRKMK-YTCQKPCCSA-N.
| Molecular formula | C5H9NO4 |
|---|---|
| Molecular weight | 148.12 g/mol |
| IUPAC name | (2S)-2-amino(113C)pentanedioic acid |
| InChIKey | WHUUTDBJXJRKMK-YTCQKPCCSA-N |
| SMILES | C(CC(=O)O)[C@@H]([13C](=O)O)N |
Computed by PubChem (NCBI)