CAS 1434127-00-0 is the registry number for Benzyl ((3S,4S)-3-fluoropiperidin-4-yl)carbamate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Benzyl N-[(3S,4S)-3-fluoropiperidin-4-yl]carbamate (CAS 1434127-00-0) is a chemical compound with the molecular formula C13H17FN2O2 and a molecular weight of 252.28 g/mol. IUPAC name: benzyl N-[(3S,4S)-3-fluoropiperidin-4-yl]carbamate. InChIKey: DWPWWTIOOLQURY-RYUDHWBXSA-N.
| Molecular formula | C13H17FN2O2 |
|---|---|
| Molecular weight | 252.28 g/mol |
| IUPAC name | benzyl N-[(3S,4S)-3-fluoropiperidin-4-yl]carbamate |
| InChIKey | DWPWWTIOOLQURY-RYUDHWBXSA-N |
| SMILES | C1CNC[C@@H]([C@H]1NC(=O)OCC2=CC=CC=C2)F |
Computed by PubChem (NCBI)