CAS 1268520-82-6 is the registry number for Cis-1-cbz-4-amino-3-fluoropiperidine, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Benzyl (3R,4S)-4-amino-3-fluoropiperidine-1-carboxylate (CAS 1268520-82-6) is a chemical compound with the molecular formula C13H17FN2O2 and a molecular weight of 252.28 g/mol. IUPAC name: benzyl (3R,4S)-4-amino-3-fluoropiperidine-1-carboxylate. InChIKey: SYVUWEZGXXHYPH-NEPJUHHUSA-N.
| Molecular formula | C13H17FN2O2 |
|---|---|
| Molecular weight | 252.28 g/mol |
| IUPAC name | benzyl (3R,4S)-4-amino-3-fluoropiperidine-1-carboxylate |
| InChIKey | SYVUWEZGXXHYPH-NEPJUHHUSA-N |
| SMILES | C1CN(C[C@H]([C@H]1N)F)C(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)