Products 1356109-81-3
CAS 1356109-81-3 appears in our catalog under these names: tert-Butyl 3-(6-fluoropyridin-2-yl)azetidine-1-carboxylate, 95%, tert–Butyl 3–(6–fluoropyridin–2–yl)azetidine–1–carboxylate. Offered by: Combi-blocks, GLPBio. Available pack sizes: 100mg, 250mg, 1g.
Tert-butyl 3-(6-fluoro-2-pyridinyl)azetidine-1-carboxylate (CAS 1356109-81-3) is a chemical compound with the molecular formula C13H17FN2O2 and a molecular weight of 252.28 g/mol. IUPAC name: tert-butyl 3-(6-fluoro-2-pyridinyl)azetidine-1-carboxylate. InChIKey: BZMVGOIBDSUZGE-UHFFFAOYSA-N.
| Molecular formula | C13H17FN2O2 |
|---|---|
| Molecular weight | 252.28 g/mol |
| IUPAC name | tert-butyl 3-(6-fluoro-2-pyridinyl)azetidine-1-carboxylate |
| InChIKey | BZMVGOIBDSUZGE-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(C1)C2=NC(=CC=C2)F |
Computed by PubChem (NCBI)