Products 14345-04-1
CAS 14345-04-1 is the registry number for 2-[(4-Chlorobenzyl)amino]benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-[(4-chlorophenyl)methylamino]benzoic acid (CAS 14345-04-1) is a chemical compound with the molecular formula C14H12ClNO2 and a molecular weight of 261.70 g/mol. IUPAC name: 2-[(4-chlorophenyl)methylamino]benzoic acid. InChIKey: PYDHJEAJTKCFKR-UHFFFAOYSA-N.
| Molecular formula | C14H12ClNO2 |
|---|---|
| Molecular weight | 261.70 g/mol |
| IUPAC name | 2-[(4-chlorophenyl)methylamino]benzoic acid |
| InChIKey | PYDHJEAJTKCFKR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)O)NCC2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)
Synonyms:
2-[(4-chlorobenzyl)amino]benzoic acid, 2-((4-Chlorobenzyl)amino)benzoic acid, 2-[(4-Chlorobenzyl)amino]benzenecarboxylic acid, 2-[(4-chlorophenyl)methylamino]benzoic acid, 2-{[(4-chlorophenyl)methyl]amino}benzoic acid, ChemDiv3_014151, Benzoic acid, 2-[[(4-chlorophenyl)methyl]amino]-, 2-((4-Chlorobenzyl)amino)benzoicacid, Benzoic acid,2-[[(4-chlorophenyl)methyl]amino]-