CAS 1434602-84-2 is the registry number for (1Z)-1-(3-Bromophenyl)ethanone oxime, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
(NZ)-N-[1-(3-bromophenyl)ethylidene]hydroxylamine (CAS 1434602-84-2) is a chemical compound with the molecular formula C8H8BrNO and a molecular weight of 214.06 g/mol. IUPAC name: (NZ)-N-[1-(3-bromophenyl)ethylidene]hydroxylamine. InChIKey: TUEQLTCSWQPJIV-POHAHGRESA-N.
| Molecular formula | C8H8BrNO |
|---|---|
| Molecular weight | 214.06 g/mol |
| IUPAC name | (NZ)-N-[1-(3-bromophenyl)ethylidene]hydroxylamine |
| InChIKey | TUEQLTCSWQPJIV-POHAHGRESA-N |
| SMILES | C/C(=N/O)/C1=CC(=CC=C1)Br |
Computed by PubChem (NCBI)