Products 27760-43-6

CAS 27760-43-6 is the registry number for 1-(4-Iodophenyl)ethan-1-one oxime, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g, 100g.

Structural formula: {0} (CAS {1})

N-[1-(3-bromophenyl)ethylidene]hydroxylamine (CAS 27760-43-6) is a chemical compound with the molecular formula C8H8BrNO and a molecular weight of 214.06 g/mol. IUPAC name: N-[1-(3-bromophenyl)ethylidene]hydroxylamine. InChIKey: TUEQLTCSWQPJIV-UHFFFAOYSA-N.

Identity
Molecular formulaC8H8BrNO
Molecular weight214.06 g/mol
IUPAC nameN-[1-(3-bromophenyl)ethylidene]hydroxylamine
InChIKeyTUEQLTCSWQPJIV-UHFFFAOYSA-N
SMILESCC(=NO)C1=CC(=CC=C1)Br

Computed by PubChem (NCBI)