Products 187672-17-9
CAS 187672-17-9 is the registry number for 1-(3-bromophenyl)ethanone oxime, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
(NE)-N-[1-(3-bromophenyl)ethylidene]hydroxylamine (CAS 187672-17-9) is a chemical compound with the molecular formula C8H8BrNO and a molecular weight of 214.06 g/mol. IUPAC name: (NE)-N-[1-(3-bromophenyl)ethylidene]hydroxylamine. InChIKey: TUEQLTCSWQPJIV-UXBLZVDNSA-N.
| Molecular formula | C8H8BrNO |
|---|---|
| Molecular weight | 214.06 g/mol |
| IUPAC name | (NE)-N-[1-(3-bromophenyl)ethylidene]hydroxylamine |
| InChIKey | TUEQLTCSWQPJIV-UXBLZVDNSA-N |
| SMILES | C/C(=N\O)/C1=CC(=CC=C1)Br |
Computed by PubChem (NCBI)