Products 1434631-73-8
CAS 1434631-73-8 is the registry number for 2-Amino-5-(difluoromethoxy)-3-methylbenzoic acid, 97%. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
2-amino-5-(difluoromethoxy)-3-methylbenzoic acid (CAS 1434631-73-8) is a chemical compound with the molecular formula C9H9F2NO3 and a molecular weight of 217.17 g/mol. IUPAC name: 2-amino-5-(difluoromethoxy)-3-methylbenzoic acid. InChIKey: LCDMISORVOXIMA-UHFFFAOYSA-N.
| Molecular formula | C9H9F2NO3 |
|---|---|
| Molecular weight | 217.17 g/mol |
| IUPAC name | 2-amino-5-(difluoromethoxy)-3-methylbenzoic acid |
| InChIKey | LCDMISORVOXIMA-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1N)C(=O)O)OC(F)F |
Computed by PubChem (NCBI)