CAS 1436382-03-4 appears in our catalog under these names: LY5, 5,8-Dioxo-6-(pyridin-3-ylamino)-5,8-dihydronaphthalene-1-sulfonamide, LY5, 97.02%. Offered by: GLPBio, Biosynth, MedChemExpress. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 5 mg, 10 mg.
5,8-dioxo-6-(pyridin-3-ylamino)naphthalene-1-sulfonamide (CAS 1436382-03-4) is a chemical compound with the molecular formula C15H11N3O4S and a molecular weight of 329.3 g/mol. IUPAC name: 5,8-dioxo-6-(pyridin-3-ylamino)naphthalene-1-sulfonamide. InChIKey: GSGMKINCHGAOPK-UHFFFAOYSA-N.
| Molecular formula | C15H11N3O4S |
|---|---|
| Molecular weight | 329.3 g/mol |
| IUPAC name | 5,8-dioxo-6-(pyridin-3-ylamino)naphthalene-1-sulfonamide |
| InChIKey | GSGMKINCHGAOPK-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)S(=O)(=O)N)C(=O)C=C(C2=O)NC3=CN=CC=C3 |
Computed by PubChem (NCBI)