CAS 853725-39-0 is the registry number for 2-((5-Nitro-1-phenyl-1H-1,3-benzodiazol-2-yl)sulfanyl)acetic acid. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
2-(5-nitro-1-phenylbenzimidazol-2-yl)sulfanylacetic acid (CAS 853725-39-0) is a chemical compound with the molecular formula C15H11N3O4S and a molecular weight of 329.3 g/mol. IUPAC name: 2-(5-nitro-1-phenylbenzimidazol-2-yl)sulfanylacetic acid. InChIKey: XEURIMHZIXZOEI-UHFFFAOYSA-N.
| Molecular formula | C15H11N3O4S |
|---|---|
| Molecular weight | 329.3 g/mol |
| IUPAC name | 2-(5-nitro-1-phenylbenzimidazol-2-yl)sulfanylacetic acid |
| InChIKey | XEURIMHZIXZOEI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C3=C(C=C(C=C3)[N+](=O)[O-])N=C2SCC(=O)O |
Computed by PubChem (NCBI)