CAS 332412-62-1 is the registry number for 2-(1,3-Benzoxazol-2-ylthio)-n-(3-nitrophenyl)acetamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2-(1,3-benzoxazol-2-ylsulfanyl)-N-(3-nitrophenyl)acetamide (CAS 332412-62-1) is a chemical compound with the molecular formula C15H11N3O4S and a molecular weight of 329.3 g/mol. IUPAC name: 2-(1,3-benzoxazol-2-ylsulfanyl)-N-(3-nitrophenyl)acetamide. InChIKey: QDDILBPXSUGCCA-UHFFFAOYSA-N.
| Molecular formula | C15H11N3O4S |
|---|---|
| Molecular weight | 329.3 g/mol |
| IUPAC name | 2-(1,3-benzoxazol-2-ylsulfanyl)-N-(3-nitrophenyl)acetamide |
| InChIKey | QDDILBPXSUGCCA-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N=C(O2)SCC(=O)NC3=CC(=CC=C3)[N+](=O)[O-] |
Computed by PubChem (NCBI)