CAS 1436426-14-0 appears in our catalog under these names: Brimonidine Impurity 23, 7-Bromoquinoxalin-6-amine 95%, 7-BROMOQUINOXALIN-6-AMINE, 95%, 95%. Offered by: Chemat Brand, Ambeed, Chemat. Available pack sizes: on request, 50mg, 100mg, 250mg, 1g.
7-bromoquinoxalin-6-amine (CAS 1436426-14-0) is a chemical compound with the molecular formula C8H6BrN3 and a molecular weight of 224.06 g/mol. IUPAC name: 7-bromoquinoxalin-6-amine. InChIKey: AFHJMMGNCKILPZ-UHFFFAOYSA-N.
| Molecular formula | C8H6BrN3 |
|---|---|
| Molecular weight | 224.06 g/mol |
| IUPAC name | 7-bromoquinoxalin-6-amine |
| InChIKey | AFHJMMGNCKILPZ-UHFFFAOYSA-N |
| SMILES | C1=CN=C2C=C(C(=CC2=N1)N)Br |
Computed by PubChem (NCBI)