Products 14365-63-0
CAS 14365-63-0 appears in our catalog under these names: 4',5'–Didehydro–5'–deoxyuridine, 4’,5’-Didehydro-5’-deoxyuridine, 4’,5’-Didehydro-5’-deoxyuridine, 4',5'-Didehydro-5'-deoxyuridine, 95%, 95%, 4',5'-Didehydro-5'-deoxyuridine, 99.25%. Offered by: GLPBio, TargetMol, Biosynth, Chemat, MedChemExpress. Available pack sizes: 100mg, 1g, 250mg, 2mg, 0,1g, 0,25g, 5mg, 10mg.
1-[(2R,3R,4S)-3,4-dihydroxy-5-methylideneoxolan-2-yl]pyrimidine-2,4-dione (CAS 14365-63-0) is a chemical compound with the molecular formula C9H10N2O5 and a molecular weight of 226.19 g/mol. IUPAC name: 1-[(2R,3R,4S)-3,4-dihydroxy-5-methylideneoxolan-2-yl]pyrimidine-2,4-dione. InChIKey: WMIBCMZGMYGWHB-BWZBUEFSSA-N.
| Molecular formula | C9H10N2O5 |
|---|---|
| Molecular weight | 226.19 g/mol |
| IUPAC name | 1-[(2R,3R,4S)-3,4-dihydroxy-5-methylideneoxolan-2-yl]pyrimidine-2,4-dione |
| InChIKey | WMIBCMZGMYGWHB-BWZBUEFSSA-N |
| SMILES | C=C1[C@H]([C@H]([C@@H](O1)N2C=CC(=O)NC2=O)O)O |
Computed by PubChem (NCBI)