CAS 14370-67-3 appears in our catalog under these names: 1,2-Di-p-tolyl-1l4,2l4-disulfane-1,2-dione, 98%, 1,2-Di-p-tolyl-1l4,2l4-disulfane-1,2-dione, 95%, 95%. Offered by: Chemat Brand, Chemat. Available pack sizes: on request, 100mg, 250mg, 1g.
1-methyl-4-(4-methylphenyl)sulfinylsulfinylbenzene (CAS 14370-67-3) is a chemical compound with the molecular formula C14H14O2S2 and a molecular weight of 278.4 g/mol. IUPAC name: 1-methyl-4-(4-methylphenyl)sulfinylsulfinylbenzene. InChIKey: UUKMDQJYNIFVSZ-UHFFFAOYSA-N.
| Molecular formula | C14H14O2S2 |
|---|---|
| Molecular weight | 278.4 g/mol |
| IUPAC name | 1-methyl-4-(4-methylphenyl)sulfinylsulfinylbenzene |
| InChIKey | UUKMDQJYNIFVSZ-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)S(=O)C2=CC=C(C=C2)C |
Computed by PubChem (NCBI)