CAS 2943-42-2 appears in our catalog under these names: P-Toluenesulfonothioic acid s-p-tolyl ester, 95%, S–p–Tolyl p–Toluenesulfonothioate, S-p-Tolyl p-Toluenesulfonothioate, >98.0%(HPLC), S-p-Tolyl 4-methylbenzenesulfonothioate, 97%, 97%. Offered by: Combi-blocks, GLPBio, TCI, Chemat. Available pack sizes: 1g, 5g, 200mg, 10g, 15g, 25g, 50g, 75g.
1-methyl-4-(4-methylphenyl)sulfonylsulfanylbenzene (CAS 2943-42-2) is a chemical compound with the molecular formula C14H14O2S2 and a molecular weight of 278.4 g/mol. IUPAC name: 1-methyl-4-(4-methylphenyl)sulfonylsulfanylbenzene. InChIKey: HSAROCRPZOYKGS-UHFFFAOYSA-N.
| Molecular formula | C14H14O2S2 |
|---|---|
| Molecular weight | 278.4 g/mol |
| IUPAC name | 1-methyl-4-(4-methylphenyl)sulfonylsulfanylbenzene |
| InChIKey | HSAROCRPZOYKGS-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)SS(=O)(=O)C2=CC=C(C=C2)C |
Computed by PubChem (NCBI)