CAS 33931-27-0 appears in our catalog under these names: 4,4'-Disulfanediylbis(2-methylphenol), 97%, 4,4'-Disulfanediylbis(2-methylphenol) 97%. Offered by: Combi-blocks, Ambeed. Available pack sizes: 1g, 100mg, 250mg, 5g.
4-[(4-hydroxy-3-methylphenyl)disulfanyl]-2-methylphenol (CAS 33931-27-0) is a chemical compound with the molecular formula C14H14O2S2 and a molecular weight of 278.4 g/mol. IUPAC name: 4-[(4-hydroxy-3-methylphenyl)disulfanyl]-2-methylphenol. InChIKey: JSWNWMXLKMYRKL-UHFFFAOYSA-N.
| Molecular formula | C14H14O2S2 |
|---|---|
| Molecular weight | 278.4 g/mol |
| IUPAC name | 4-[(4-hydroxy-3-methylphenyl)disulfanyl]-2-methylphenol |
| InChIKey | JSWNWMXLKMYRKL-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)SSC2=CC(=C(C=C2)O)C)O |
Computed by PubChem (NCBI)