CAS 143701-75-1 appears in our catalog under these names: Isoxaflutole-diketonitrile, Isoxaflutole-diketonitrile 100 µg/mL in Acetonitrile, RPA 202248, >95% (HPLC), Isoxaflutole Metabolite RPA202248, Isoxaflutole diketonitrile RPA 202248, Concentration: 100 µg/ml Solvent: Acetonitrile. Offered by: Dr. Ehrenstorfer, TRC, Sigma-Aldrich, HPC Standards. Available pack sizes: 10mg, 1ml, 2,5mg, 25mg, 1x1ml, 1x10mg.
2-(cyclopropanecarbonyl)-3-[2-methylsulfonyl-4-(trifluoromethyl)phenyl]-3-oxopropanenitrile (CAS 143701-75-1) is a chemical compound with the molecular formula C15H12F3NO4S and a molecular weight of 359.3 g/mol. IUPAC name: 2-(cyclopropanecarbonyl)-3-[2-methylsulfonyl-4-(trifluoromethyl)phenyl]-3-oxopropanenitrile. InChIKey: ZTTKDUXKVPEXCG-UHFFFAOYSA-N.
| Molecular formula | C15H12F3NO4S |
|---|---|
| Molecular weight | 359.3 g/mol |
| IUPAC name | 2-(cyclopropanecarbonyl)-3-[2-methylsulfonyl-4-(trifluoromethyl)phenyl]-3-oxopropanenitrile |
| InChIKey | ZTTKDUXKVPEXCG-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=C(C=CC(=C1)C(F)(F)F)C(=O)C(C#N)C(=O)C2CC2 |
Computed by PubChem (NCBI)