Products 337921-88-7

CAS 337921-88-7 is the registry number for N-(Phenylsulfonyl)-n-[3-(trifluoromethyl)phenyl]glycine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

2-[N-(benzenesulfonyl)-3-(trifluoromethyl)anilino]acetic acid (CAS 337921-88-7) is a chemical compound with the molecular formula C15H12F3NO4S and a molecular weight of 359.3 g/mol. IUPAC name: 2-[N-(benzenesulfonyl)-3-(trifluoromethyl)anilino]acetic acid. InChIKey: NRZLNHKNFJGXHG-UHFFFAOYSA-N.

Identity
Molecular formulaC15H12F3NO4S
Molecular weight359.3 g/mol
IUPAC name2-[N-(benzenesulfonyl)-3-(trifluoromethyl)anilino]acetic acid
InChIKeyNRZLNHKNFJGXHG-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)S(=O)(=O)N(CC(=O)O)C2=CC=CC(=C2)C(F)(F)F

Computed by PubChem (NCBI)