Products 690645-93-3

CAS 690645-93-3 is the registry number for 4-[(([3-(Trifluoromethyl)phenyl]sulfonyl)amino)methyl]benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

4-[[[3-(trifluoromethyl)phenyl]sulfonylamino]methyl]benzoic acid (CAS 690645-93-3) is a chemical compound with the molecular formula C15H12F3NO4S and a molecular weight of 359.3 g/mol. IUPAC name: 4-[[[3-(trifluoromethyl)phenyl]sulfonylamino]methyl]benzoic acid. InChIKey: YULRKVYOEFOBSH-UHFFFAOYSA-N.

Identity
Molecular formulaC15H12F3NO4S
Molecular weight359.3 g/mol
IUPAC name4-[[[3-(trifluoromethyl)phenyl]sulfonylamino]methyl]benzoic acid
InChIKeyYULRKVYOEFOBSH-UHFFFAOYSA-N
SMILESC1=CC(=CC(=C1)S(=O)(=O)NCC2=CC=C(C=C2)C(=O)O)C(F)(F)F

Computed by PubChem (NCBI)