CAS 1437052-32-8 appears in our catalog under these names: 6-Methyl-1H-spiro(2,1-benzoxaborole-3,1'-cyclopentane)-1-ol, 95%, 6-Methyl-1H-spiro(2,1-benzoxaborole-3,1'-cyclopentane)-1-ol. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
1-hydroxy-6-methylspiro[2,1-benzoxaborole-3,1'-cyclopentane] (CAS 1437052-32-8) is a chemical compound with the molecular formula C12H15BO2 and a molecular weight of 202.06 g/mol. IUPAC name: 1-hydroxy-6-methylspiro[2,1-benzoxaborole-3,1'-cyclopentane]. InChIKey: MMTAZHNMTZHOSA-UHFFFAOYSA-N.
| Molecular formula | C12H15BO2 |
|---|---|
| Molecular weight | 202.06 g/mol |
| IUPAC name | 1-hydroxy-6-methylspiro[2,1-benzoxaborole-3,1'-cyclopentane] |
| InChIKey | MMTAZHNMTZHOSA-UHFFFAOYSA-N |
| SMILES | B1(C2=C(C=CC(=C2)C)C3(O1)CCCC3)O |
Computed by PubChem (NCBI)