Products 1914060-06-2

CAS 1914060-06-2 is the registry number for 4-(Cyclohex-1-en-1-yl)phenylboronic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.

Structural formula: {0} (CAS {1})

[4-(cyclohexen-1-yl)phenyl]boronic acid (CAS 1914060-06-2) is a chemical compound with the molecular formula C12H15BO2 and a molecular weight of 202.06 g/mol. IUPAC name: [4-(cyclohexen-1-yl)phenyl]boronic acid. InChIKey: CYLLYELXGUEYMB-UHFFFAOYSA-N.

Identity
Molecular formulaC12H15BO2
Molecular weight202.06 g/mol
IUPAC name[4-(cyclohexen-1-yl)phenyl]boronic acid
InChIKeyCYLLYELXGUEYMB-UHFFFAOYSA-N
SMILESB(C1=CC=C(C=C1)C2=CCCCC2)(O)O

Computed by PubChem (NCBI)