Products 2225172-67-6

CAS 2225172-67-6 appears in our catalog under these names: 3,5–Dicyclopropylphenylboronic acid, (3,5-Dicyclopropylphenyl)boronic acid, 98%, 98%, (3,5-Dicyclopropylphenyl)boronic acid, 98%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 25mg, 100mg.

Structural formula: {0} (CAS {1})

(3,5-dicyclopropylphenyl)boronic acid (CAS 2225172-67-6) is a chemical compound with the molecular formula C12H15BO2 and a molecular weight of 202.06 g/mol. IUPAC name: (3,5-dicyclopropylphenyl)boronic acid. InChIKey: LSKFBXLJRLUIPP-UHFFFAOYSA-N.

Identity
Molecular formulaC12H15BO2
Molecular weight202.06 g/mol
IUPAC name(3,5-dicyclopropylphenyl)boronic acid
InChIKeyLSKFBXLJRLUIPP-UHFFFAOYSA-N
SMILESB(C1=CC(=CC(=C1)C2CC2)C3CC3)(O)O

Computed by PubChem (NCBI)