CAS 2225172-67-6 appears in our catalog under these names: 3,5–Dicyclopropylphenylboronic acid, (3,5-Dicyclopropylphenyl)boronic acid, 98%, 98%, (3,5-Dicyclopropylphenyl)boronic acid, 98%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 25mg, 100mg.
(3,5-dicyclopropylphenyl)boronic acid (CAS 2225172-67-6) is a chemical compound with the molecular formula C12H15BO2 and a molecular weight of 202.06 g/mol. IUPAC name: (3,5-dicyclopropylphenyl)boronic acid. InChIKey: LSKFBXLJRLUIPP-UHFFFAOYSA-N.
| Molecular formula | C12H15BO2 |
|---|---|
| Molecular weight | 202.06 g/mol |
| IUPAC name | (3,5-dicyclopropylphenyl)boronic acid |
| InChIKey | LSKFBXLJRLUIPP-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1)C2CC2)C3CC3)(O)O |
Computed by PubChem (NCBI)