Products 1437312-14-5
CAS 1437312-14-5 is the registry number for 2-(1H-Pyrazol-1-yl)thiazole-4-carboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-pyrazol-1-yl-1,3-thiazole-4-carboxylic acid (CAS 1437312-14-5) is a chemical compound with the molecular formula C7H5N3O2S and a molecular weight of 195.20 g/mol. IUPAC name: 2-pyrazol-1-yl-1,3-thiazole-4-carboxylic acid. InChIKey: VORLYPGNZXRIBF-UHFFFAOYSA-N.
| Molecular formula | C7H5N3O2S |
|---|---|
| Molecular weight | 195.20 g/mol |
| IUPAC name | 2-pyrazol-1-yl-1,3-thiazole-4-carboxylic acid |
| InChIKey | VORLYPGNZXRIBF-UHFFFAOYSA-N |
| SMILES | C1=CN(N=C1)C2=NC(=CS2)C(=O)O |
Computed by PubChem (NCBI)