Products 1437435-22-7
CAS 1437435-22-7 is the registry number for 4-Chloro-2-(tetrahydrofuran-2-yl)pyrido(3,4-d)pyrimidine. Offered by: Biosynth. Available pack sizes: 500mg, 250mg, 1000mg, 5000mg, 2000mg.
4-chloro-2-(oxolan-2-yl)pyrido[3,4-d]pyrimidine (CAS 1437435-22-7) is a chemical compound with the molecular formula C11H10ClN3O and a molecular weight of 235.67 g/mol. IUPAC name: 4-chloro-2-(oxolan-2-yl)pyrido[3,4-d]pyrimidine. InChIKey: MUSBCYDPXVXHLR-UHFFFAOYSA-N.
| Molecular formula | C11H10ClN3O |
|---|---|
| Molecular weight | 235.67 g/mol |
| IUPAC name | 4-chloro-2-(oxolan-2-yl)pyrido[3,4-d]pyrimidine |
| InChIKey | MUSBCYDPXVXHLR-UHFFFAOYSA-N |
| SMILES | C1CC(OC1)C2=NC3=C(C=CN=C3)C(=N2)Cl |
Computed by PubChem (NCBI)