CAS 1437794-73-4 is the registry number for 5-Methoxy-2-nitro-N-propylaniline, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 25g, 1g, 5g.
5-methoxy-2-nitro-N-propylaniline (CAS 1437794-73-4) is a chemical compound with the molecular formula C10H14N2O3 and a molecular weight of 210.23 g/mol. IUPAC name: 5-methoxy-2-nitro-N-propylaniline. InChIKey: VGOVMCNHSWOEJM-UHFFFAOYSA-N.
| Molecular formula | C10H14N2O3 |
|---|---|
| Molecular weight | 210.23 g/mol |
| IUPAC name | 5-methoxy-2-nitro-N-propylaniline |
| InChIKey | VGOVMCNHSWOEJM-UHFFFAOYSA-N |
| SMILES | CCCNC1=C(C=CC(=C1)OC)[N+](=O)[O-] |
Computed by PubChem (NCBI)