CAS 1437794-86-9 is the registry number for 5-Ethoxy-2-nitro-N-propylaniline, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 25g, 1g, 5g.
5-ethoxy-2-nitro-N-propylaniline (CAS 1437794-86-9) is a chemical compound with the molecular formula C11H16N2O3 and a molecular weight of 224.26 g/mol. IUPAC name: 5-ethoxy-2-nitro-N-propylaniline. InChIKey: RECKTXGBISIUPR-UHFFFAOYSA-N.
| Molecular formula | C11H16N2O3 |
|---|---|
| Molecular weight | 224.26 g/mol |
| IUPAC name | 5-ethoxy-2-nitro-N-propylaniline |
| InChIKey | RECKTXGBISIUPR-UHFFFAOYSA-N |
| SMILES | CCCNC1=C(C=CC(=C1)OCC)[N+](=O)[O-] |
Computed by PubChem (NCBI)