Products 1438852-69-7
CAS 1438852-69-7 is the registry number for Methyl (S)-1-benzyl-3-fluoropyrrolidine-3-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl (3S)-1-benzyl-3-fluoropyrrolidine-3-carboxylate (CAS 1438852-69-7) is a chemical compound with the molecular formula C13H16FNO2 and a molecular weight of 237.27 g/mol. IUPAC name: methyl (3S)-1-benzyl-3-fluoropyrrolidine-3-carboxylate. InChIKey: UQMVXIDFYRQQIS-ZDUSSCGKSA-N.
| Molecular formula | C13H16FNO2 |
|---|---|
| Molecular weight | 237.27 g/mol |
| IUPAC name | methyl (3S)-1-benzyl-3-fluoropyrrolidine-3-carboxylate |
| InChIKey | UQMVXIDFYRQQIS-ZDUSSCGKSA-N |
| SMILES | COC(=O)[C@@]1(CCN(C1)CC2=CC=CC=C2)F |
Computed by PubChem (NCBI)