CAS 143945-65-7 appears in our catalog under these names: 2–Amino–5–bromo–4–fluorobenzoic acid, Benzoic acid, 2-amino-5-bromo-4-fluoro-, 97%, 97%, 2-Amino-5-bromo-4-fluorobenzoic acid, 95%, 2-Amino-5-bromo-4-fluorobenzoic acid, 97%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 100g, 10g, 25g, 250mg, 1g, 5g, 500g, 50g.
2-amino-5-bromo-4-fluorobenzoic acid (CAS 143945-65-7) is a chemical compound with the molecular formula C7H5BrFNO2 and a molecular weight of 234.02 g/mol. IUPAC name: 2-amino-5-bromo-4-fluorobenzoic acid. InChIKey: RPHQHEBXMAGQKB-UHFFFAOYSA-N.
| Molecular formula | C7H5BrFNO2 |
|---|---|
| Molecular weight | 234.02 g/mol |
| IUPAC name | 2-amino-5-bromo-4-fluorobenzoic acid |
| InChIKey | RPHQHEBXMAGQKB-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1Br)F)N)C(=O)O |
Computed by PubChem (NCBI)