CAS 143979-40-2 appears in our catalog under these names: rac N-Boc-3,3-dimethyl-2-pyrrolidenecarboxylic Acid, Rac N-Boc-3,3-dimethyl-2-pyrrolidinecarboxylic acid, 95%, Boc-DL-Pro(3,3-Me2)-OH, 97%, Boc-3,3-dmP-OH (rac), rac N-Boc-3,3-dimethyl-2-pyrrolidenecarboxylic Acid, 97%, 97%. Offered by: TRC, Combi-blocks, AmBeed, Iris Biotech, Chemat. Available pack sizes: 100mg, 25mg, 50mg, 250mg, 1g, 5g, 10g, 500mg.
3,3-dimethyl-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid (CAS 143979-40-2) is a chemical compound with the molecular formula C12H21NO4 and a molecular weight of 243.30 g/mol. IUPAC name: 3,3-dimethyl-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid. InChIKey: FVTWJYOGVFLUNJ-UHFFFAOYSA-N.
| Molecular formula | C12H21NO4 |
|---|---|
| Molecular weight | 243.30 g/mol |
| IUPAC name | 3,3-dimethyl-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid |
| InChIKey | FVTWJYOGVFLUNJ-UHFFFAOYSA-N |
| SMILES | CC1(CCN(C1C(=O)O)C(=O)OC(C)(C)C)C |
Computed by PubChem (NCBI)