CAS 144060-98-0 appears in our catalog under these names: 4-Methyl-2-(pyridin-4-yl)thiazole-5-carboxylic acid, 98%, 98%, 2–(4–Pyridyl)–4–methyl–thiazole–5–Carboxylic Acid, 2-(4-Pyridyl)-4-methyl-thiazole-5-carboxylic acid, 98.0%, 4-Methyl-2-pyridin-4-yl-thiazole-5-carboxylic acid, 95%, 4-Methyl-2-(pyridin-4-yl)thiazole-5-carboxylic acid, 98%. Offered by: Chemat, GLPBio, MedChemExpress, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g, 500mg, 100 mg, 25g.
4-methyl-2-pyridin-4-yl-1,3-thiazole-5-carboxylic acid (CAS 144060-98-0) is a chemical compound with the molecular formula C10H8N2O2S and a molecular weight of 220.25 g/mol. IUPAC name: 4-methyl-2-pyridin-4-yl-1,3-thiazole-5-carboxylic acid. InChIKey: WAIPVXWDQQHMQG-UHFFFAOYSA-N.
| Molecular formula | C10H8N2O2S |
|---|---|
| Molecular weight | 220.25 g/mol |
| IUPAC name | 4-methyl-2-pyridin-4-yl-1,3-thiazole-5-carboxylic acid |
| InChIKey | WAIPVXWDQQHMQG-UHFFFAOYSA-N |
| SMILES | CC1=C(SC(=N1)C2=CC=NC=C2)C(=O)O |
Computed by PubChem (NCBI)