CAS 144073-15-4 appears in our catalog under these names: Fmoc-D-Ala-Cl, 95+%, Fmoc-D-Ala-Cl, 95%, 95%. Offered by: AmBeed, Chemat. Available pack sizes: 5g, 100mg, 250mg, 500mg, 1g.
9H-fluoren-9-ylmethyl N-[(2R)-1-chloro-1-oxopropan-2-yl]carbamate (CAS 144073-15-4) is a chemical compound with the molecular formula C18H16ClNO3 and a molecular weight of 329.8 g/mol. IUPAC name: 9H-fluoren-9-ylmethyl N-[(2R)-1-chloro-1-oxopropan-2-yl]carbamate. InChIKey: AFMYCMGTXVCJCH-LLVKDONJSA-N.
| Molecular formula | C18H16ClNO3 |
|---|---|
| Molecular weight | 329.8 g/mol |
| IUPAC name | 9H-fluoren-9-ylmethyl N-[(2R)-1-chloro-1-oxopropan-2-yl]carbamate |
| InChIKey | AFMYCMGTXVCJCH-LLVKDONJSA-N |
| SMILES | C[C@H](C(=O)Cl)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)