Products 51234-41-4
CAS 51234-41-4 is the registry number for Benoxaprofen Ethyl Ester. Offered by: Mikromol. Available pack sizes: 25mg.
Ethyl 2-[2-(4-chlorophenyl)-1,3-benzoxazol-5-yl]propanoate (CAS 51234-41-4) is a chemical compound with the molecular formula C18H16ClNO3 and a molecular weight of 329.8 g/mol. IUPAC name: ethyl 2-[2-(4-chlorophenyl)-1,3-benzoxazol-5-yl]propanoate. InChIKey: MUAYIAAIKPJCDG-UHFFFAOYSA-N.
| Molecular formula | C18H16ClNO3 |
|---|---|
| Molecular weight | 329.8 g/mol |
| IUPAC name | ethyl 2-[2-(4-chlorophenyl)-1,3-benzoxazol-5-yl]propanoate |
| InChIKey | MUAYIAAIKPJCDG-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C)C1=CC2=C(C=C1)OC(=N2)C3=CC=C(C=C3)Cl |
Computed by PubChem (NCBI)