Products 1820604-36-1
CAS 1820604-36-1 is the registry number for methyl 2-chloro-4-[3-(cyclopropylcarbamoyl)phenyl]benzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
Methyl 2-chloro-4-[3-(cyclopropylcarbamoyl)phenyl]benzoate (CAS 1820604-36-1) is a chemical compound with the molecular formula C18H16ClNO3 and a molecular weight of 329.8 g/mol. IUPAC name: methyl 2-chloro-4-[3-(cyclopropylcarbamoyl)phenyl]benzoate. InChIKey: CWRTYDGZCLHIEM-UHFFFAOYSA-N.
| Molecular formula | C18H16ClNO3 |
|---|---|
| Molecular weight | 329.8 g/mol |
| IUPAC name | methyl 2-chloro-4-[3-(cyclopropylcarbamoyl)phenyl]benzoate |
| InChIKey | CWRTYDGZCLHIEM-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=C(C=C1)C2=CC(=CC=C2)C(=O)NC3CC3)Cl |
Computed by PubChem (NCBI)