Products 144085-32-5
CAS 144085-32-5 appears in our catalog under these names: Angiotensin I-Converting Enzyme (ACE) Inactivator, Angiotensin I-Converting Enzyme (ACE) Inactivator Cyanoac-Phe-Phe-OH. Offered by: Creative Peptides, Biosynth. Available pack sizes: on request, 500mg, 250mg, 1000mg.
(2S)-2-[[(2S)-2-[(2-cyanoacetyl)amino]-3-phenylpropanoyl]amino]-3-phenylpropanoic acid (CAS 144085-32-5) is a chemical compound with the molecular formula C21H21N3O4 and a molecular weight of 379.4 g/mol. IUPAC name: (2S)-2-[[(2S)-2-[(2-cyanoacetyl)amino]-3-phenylpropanoyl]amino]-3-phenylpropanoic acid. InChIKey: FPAPTZAOPMWDRV-ROUUACIJSA-N.
| Molecular formula | C21H21N3O4 |
|---|---|
| Molecular weight | 379.4 g/mol |
| IUPAC name | (2S)-2-[[(2S)-2-[(2-cyanoacetyl)amino]-3-phenylpropanoyl]amino]-3-phenylpropanoic acid |
| InChIKey | FPAPTZAOPMWDRV-ROUUACIJSA-N |
| SMILES | C1=CC=C(C=C1)C[C@@H](C(=O)N[C@@H](CC2=CC=CC=C2)C(=O)O)NC(=O)CC#N |
Computed by PubChem (NCBI)